C21H24Cl2N4O3 — CID 169205974
chlorobenzene;4-[5-chloro-2-(2-hydroxypropan-2-ylamino)-4-pyridinyl]-N-(2-hydroxyethyl)-1H-pyrrole-2-carboxamide (PubChem CID 169205974) has the molecular formula C21H24Cl2N4O3 and a molecular weight of 451.35 g/mol. Its IUPAC name is chlorobenzene;4-[5-chloro-2-(2-hydroxypropan-2-ylamino)-4-pyridinyl]-N-(2-hydroxyethyl)-1H-pyrrole-2-carboxamide.
| Compound Name | chlorobenzene;4-[5-chloro-2-(2-hydroxypropan-2-ylamino)-4-pyridinyl]-N-(2-hydroxyethyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 169205974 |
| Molecular Formula | C21H24Cl2N4O3 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | chlorobenzene;4-[5-chloro-2-(2-hydroxypropan-2-ylamino)-4-pyridinyl]-N-(2-hydroxyethyl)-1H-pyrrole-2-carboxamide |
| SMILES | CC(C)(O)Nc1cc(-c2c[nH]c(C(=O)NCCO)c2)c(Cl)cn1.Clc1ccccc1 |
| InChI | InChI=1S/C15H19ClN4O3.C6H5Cl/c1-15(2,23)20-13-6-10(11(16)8-19-13)9-5-12(18-7-9)14(22)17-3-4-21;7-6-4-2-1-3-5-6/h5-8,18,21,23H,3-4H2,1-2H3,(H,17,22)(H,19,20);1-5H |
| InChIKey | OODAWORHOISEPA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|