C15H18BClN4O7 — CID 169205980
CID 169205980 (PubChem CID 169205980) has the molecular formula C15H18BClN4O7 and a molecular weight of 412.60 g/mol.
| Compound Name | CID 169205980 |
|---|---|
| PubChem CID | 169205980 |
| Molecular Formula | C15H18BClN4O7 |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | — |
| SMILES | [B]C(O)(O)C(Nc1cc(-c2c[nH]c(C(=O)NCCO)c2)c(Cl)cn1)C(O)(O)O |
| InChI | InChI=1S/C15H18BClN4O7/c16-14(24,25)13(15(26,27)28)21-11-4-8(9(17)6-20-11)7-3-10(19-5-7)12(23)18-1-2-22/h3-6,13,19,22,24-28H,1-2H2,(H,18,23)(H,20,21) |
| InChIKey | AGKXCIQFVKTSCA-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 191.19 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|