C19H21NO5S — CID 163208050
4-acetyl-N-[1-(4-ethylsulfonylphenyl)-2-hydroxyethyl]benzamide (PubChem CID 163208050) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is 4-acetyl-N-[1-(4-ethylsulfonylphenyl)-2-hydroxyethyl]benzamide.
| Compound Name | 4-acetyl-N-[1-(4-ethylsulfonylphenyl)-2-hydroxyethyl]benzamide |
|---|---|
| PubChem CID | 163208050 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 4-acetyl-N-[1-(4-ethylsulfonylphenyl)-2-hydroxyethyl]benzamide |
| SMILES | CCS(=O)(=O)c1ccc(C(CO)NC(=O)c2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C19H21NO5S/c1-3-26(24,25)17-10-8-15(9-11-17)18(12-21)20-19(23)16-6-4-14(5-7-16)13(2)22/h4-11,18,21H,3,12H2,1-2H3,(H,20,23) |
| InChIKey | OLROROPIFFMXFJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |