C13H16ClFN2O3 — CID 178028591
tert-butyl N-[(1S)-2-amino-1-(4-chloro-3-fluorophenyl)-2-oxoethyl]carbamate (PubChem CID 178028591) has the molecular formula C13H16ClFN2O3 and a molecular weight of 302.73 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-amino-1-(4-chloro-3-fluorophenyl)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-amino-1-(4-chloro-3-fluorophenyl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 178028591 |
| Molecular Formula | C13H16ClFN2O3 |
| Molecular Weight | 302.73 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | tert-butyl N-[(1S)-2-amino-1-(4-chloro-3-fluorophenyl)-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(N)=O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C13H16ClFN2O3/c1-13(2,3)20-12(19)17-10(11(16)18)7-4-5-8(14)9(15)6-7/h4-6,10H,1-3H3,(H2,16,18)(H,17,19)/t10-/m0/s1 |
| InChIKey | WWXSPOQZRIMIBO-JTQLQIEISA-N |
| XLogP | 2.53 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.73 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |