C13H16F2N2O3 — CID 58180376
tert-butyl N-[2-amino-1-(2,4-difluorophenyl)-2-oxoethyl]carbamate (PubChem CID 58180376) has the molecular formula C13H16F2N2O3 and a molecular weight of 286.28 g/mol. Its IUPAC name is tert-butyl N-[2-amino-1-(2,4-difluorophenyl)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-amino-1-(2,4-difluorophenyl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 58180376 |
| Molecular Formula | C13H16F2N2O3 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | tert-butyl N-[2-amino-1-(2,4-difluorophenyl)-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C(N)=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H16F2N2O3/c1-13(2,3)20-12(19)17-10(11(16)18)8-5-4-7(14)6-9(8)15/h4-6,10H,1-3H3,(H2,16,18)(H,17,19) |
| InChIKey | GDTJTZDNTCPJRX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |