C24H24ClFN2O4S — CID 42988884
3-[benzyl-(4-fluorophenyl)sulfamoyl]-4-chloro-N-(1-methoxypropan-2-yl)benzamide (PubChem CID 42988884) has the molecular formula C24H24ClFN2O4S and a molecular weight of 490.98 g/mol. Its IUPAC name is 3-[benzyl-(4-fluorophenyl)sulfamoyl]-4-chloro-N-(1-methoxypropan-2-yl)benzamide.
| Compound Name | 3-[benzyl-(4-fluorophenyl)sulfamoyl]-4-chloro-N-(1-methoxypropan-2-yl)benzamide |
|---|---|
| PubChem CID | 42988884 |
| Molecular Formula | C24H24ClFN2O4S |
| Molecular Weight | 490.98 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 3-[benzyl-(4-fluorophenyl)sulfamoyl]-4-chloro-N-(1-methoxypropan-2-yl)benzamide |
| SMILES | COCC(C)NC(=O)c1ccc(Cl)c(S(=O)(=O)N(Cc2ccccc2)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C24H24ClFN2O4S/c1-17(16-32-2)27-24(29)19-8-13-22(25)23(14-19)33(30,31)28(15-18-6-4-3-5-7-18)21-11-9-20(26)10-12-21/h3-14,17H,15-16H2,1-2H3,(H,27,29) |
| InChIKey | DRIQUGXYVSQFAS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.98 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |