C25H27FN2O3S — CID 19062213
4-[(4-fluorophenyl)methyl-methylsulfonylamino]-N-(4-phenylbutan-2-yl)benzamide (PubChem CID 19062213) has the molecular formula C25H27FN2O3S and a molecular weight of 454.57 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)methyl-methylsulfonylamino]-N-(4-phenylbutan-2-yl)benzamide.
| Compound Name | 4-[(4-fluorophenyl)methyl-methylsulfonylamino]-N-(4-phenylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 19062213 |
| Molecular Formula | C25H27FN2O3S |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 4-[(4-fluorophenyl)methyl-methylsulfonylamino]-N-(4-phenylbutan-2-yl)benzamide |
| SMILES | CC(CCc1ccccc1)NC(=O)c1ccc(N(Cc2ccc(F)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C25H27FN2O3S/c1-19(8-9-20-6-4-3-5-7-20)27-25(29)22-12-16-24(17-13-22)28(32(2,30)31)18-21-10-14-23(26)15-11-21/h3-7,10-17,19H,8-9,18H2,1-2H3,(H,27,29) |
| InChIKey | VQNHBFNKRQKYHF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |