C28H25FN2O3S — CID 94019026
4-[[N-(benzenesulfonyl)anilino]methyl]-N-[(1S)-1-(4-fluorophenyl)ethyl]benzamide (PubChem CID 94019026) has the molecular formula C28H25FN2O3S and a molecular weight of 488.58 g/mol. Its IUPAC name is 4-[[N-(benzenesulfonyl)anilino]methyl]-N-[(1S)-1-(4-fluorophenyl)ethyl]benzamide.
| Compound Name | 4-[[N-(benzenesulfonyl)anilino]methyl]-N-[(1S)-1-(4-fluorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 94019026 |
| Molecular Formula | C28H25FN2O3S |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 4-[[N-(benzenesulfonyl)anilino]methyl]-N-[(1S)-1-(4-fluorophenyl)ethyl]benzamide |
| SMILES | C[C@H](NC(=O)c1ccc(CN(c2ccccc2)S(=O)(=O)c2ccccc2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H25FN2O3S/c1-21(23-16-18-25(29)19-17-23)30-28(32)24-14-12-22(13-15-24)20-31(26-8-4-2-5-9-26)35(33,34)27-10-6-3-7-11-27/h2-19,21H,20H2,1H3,(H,30,32)/t21-/m0/s1 |
| InChIKey | ZJZUZLNAIRZYGT-NRFANRHFSA-N |
| XLogP | 5.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |