C26H21ClFN3O3S — CID 2119625
3-[benzyl-(4-fluorophenyl)sulfamoyl]-4-chloro-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 2119625) has the molecular formula C26H21ClFN3O3S and a molecular weight of 509.99 g/mol. Its IUPAC name is 3-[benzyl-(4-fluorophenyl)sulfamoyl]-4-chloro-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | 3-[benzyl-(4-fluorophenyl)sulfamoyl]-4-chloro-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 2119625 |
| Molecular Formula | C26H21ClFN3O3S |
| Molecular Weight | 509.99 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | 3-[benzyl-(4-fluorophenyl)sulfamoyl]-4-chloro-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccccn1)c1ccc(Cl)c(S(=O)(=O)N(Cc2ccccc2)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C26H21ClFN3O3S/c27-24-14-9-20(26(32)30-17-22-8-4-5-15-29-22)16-25(24)35(33,34)31(18-19-6-2-1-3-7-19)23-12-10-21(28)11-13-23/h1-16H,17-18H2,(H,30,32) |
| InChIKey | WFZLEBHMVZPNAX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.99 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |