C23H28ClF2N5O2 — CID 118376230
4-chloro-N-[N-[1,3-diamino-3-(3,5-difluorophenyl)propyl]-N'-[(2-methyloxolan-2-yl)methyl]carbamimidoyl]benzamide (PubChem CID 118376230) has the molecular formula C23H28ClF2N5O2 and a molecular weight of 479.96 g/mol. Its IUPAC name is 4-chloro-N-[N-[1,3-diamino-3-(3,5-difluorophenyl)propyl]-N'-[(2-methyloxolan-2-yl)methyl]carbamimidoyl]benzamide.
| Compound Name | 4-chloro-N-[N-[1,3-diamino-3-(3,5-difluorophenyl)propyl]-N'-[(2-methyloxolan-2-yl)methyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 118376230 |
| Molecular Formula | C23H28ClF2N5O2 |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 4-chloro-N-[N-[1,3-diamino-3-(3,5-difluorophenyl)propyl]-N'-[(2-methyloxolan-2-yl)methyl]carbamimidoyl]benzamide |
| SMILES | CC1(C/N=C(\NC(=O)c2ccc(Cl)cc2)NC(N)CC(N)c2cc(F)cc(F)c2)CCCO1 |
| InChI | InChI=1S/C23H28ClF2N5O2/c1-23(7-2-8-33-23)13-29-22(31-21(32)14-3-5-16(24)6-4-14)30-20(28)12-19(27)15-9-17(25)11-18(26)10-15/h3-6,9-11,19-20H,2,7-8,12-13,27-28H2,1H3,(H2,29,30,31,32) |
| InChIKey | IGDQBTVSTRNKLA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|