C22H26ClF2N5O2 — CID 118376335
N-[N-[3-(4-chlorophenyl)-1-(methylamino)-3-nitrosopropyl]-N'-(2-methylpropyl)carbamimidoyl]-3,4-difluorobenzamide (PubChem CID 118376335) has the molecular formula C22H26ClF2N5O2 and a molecular weight of 465.93 g/mol. Its IUPAC name is N-[N-[3-(4-chlorophenyl)-1-(methylamino)-3-nitrosopropyl]-N'-(2-methylpropyl)carbamimidoyl]-3,4-difluorobenzamide.
| Compound Name | N-[N-[3-(4-chlorophenyl)-1-(methylamino)-3-nitrosopropyl]-N'-(2-methylpropyl)carbamimidoyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 118376335 |
| Molecular Formula | C22H26ClF2N5O2 |
| Molecular Weight | 465.93 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | N-[N-[3-(4-chlorophenyl)-1-(methylamino)-3-nitrosopropyl]-N'-(2-methylpropyl)carbamimidoyl]-3,4-difluorobenzamide |
| SMILES | CNC(CC(N=O)c1ccc(Cl)cc1)N/C(=N/CC(C)C)NC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H26ClF2N5O2/c1-13(2)12-27-22(29-21(31)15-6-9-17(24)18(25)10-15)28-20(26-3)11-19(30-32)14-4-7-16(23)8-5-14/h4-10,13,19-20,26H,11-12H2,1-3H3,(H2,27,28,29,31) |
| InChIKey | GSDFPSGPYFSMPF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.93 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|