C23H27F4N5O3 — CID 118376444
N-[N-[3-(2-fluoro-4-hydroxyphenyl)-1-(methylamino)-3-nitrosopropyl]-N'-(2-methylpropyl)carbamimidoyl]-4-(trifluoromethyl)benzamide (PubChem CID 118376444) has the molecular formula C23H27F4N5O3 and a molecular weight of 497.49 g/mol. Its IUPAC name is N-[N-[3-(2-fluoro-4-hydroxyphenyl)-1-(methylamino)-3-nitrosopropyl]-N'-(2-methylpropyl)carbamimidoyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[N-[3-(2-fluoro-4-hydroxyphenyl)-1-(methylamino)-3-nitrosopropyl]-N'-(2-methylpropyl)carbamimidoyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 118376444 |
| Molecular Formula | C23H27F4N5O3 |
| Molecular Weight | 497.49 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | N-[N-[3-(2-fluoro-4-hydroxyphenyl)-1-(methylamino)-3-nitrosopropyl]-N'-(2-methylpropyl)carbamimidoyl]-4-(trifluoromethyl)benzamide |
| SMILES | CNC(CC(N=O)c1ccc(O)cc1F)N/C(=N/CC(C)C)NC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H27F4N5O3/c1-13(2)12-29-22(31-21(34)14-4-6-15(7-5-14)23(25,26)27)30-20(28-3)11-19(32-35)17-9-8-16(33)10-18(17)24/h4-10,13,19-20,28,33H,11-12H2,1-3H3,(H2,29,30,31,34) |
| InChIKey | SMNHDIQKKCBCCP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 115.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|