C25H34F3N5O — CID 123620973
N-[N-[[ethyl(propyl)amino]-[3-fluoro-2-(methylamino)phenyl]methyl]-N'-(2-methylpropyl)carbamimidoyl]-3,4-difluorobenzamide (PubChem CID 123620973) has the molecular formula C25H34F3N5O and a molecular weight of 477.58 g/mol. Its IUPAC name is N-[N-[[ethyl(propyl)amino]-[3-fluoro-2-(methylamino)phenyl]methyl]-N'-(2-methylpropyl)carbamimidoyl]-3,4-difluorobenzamide.
| Compound Name | N-[N-[[ethyl(propyl)amino]-[3-fluoro-2-(methylamino)phenyl]methyl]-N'-(2-methylpropyl)carbamimidoyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 123620973 |
| Molecular Formula | C25H34F3N5O |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | N-[N-[[ethyl(propyl)amino]-[3-fluoro-2-(methylamino)phenyl]methyl]-N'-(2-methylpropyl)carbamimidoyl]-3,4-difluorobenzamide |
| SMILES | CCCN(CC)C(N/C(=N/CC(C)C)NC(=O)c1ccc(F)c(F)c1)c1cccc(F)c1NC |
| InChI | InChI=1S/C25H34F3N5O/c1-6-13-33(7-2)23(18-9-8-10-20(27)22(18)29-5)31-25(30-15-16(3)4)32-24(34)17-11-12-19(26)21(28)14-17/h8-12,14,16,23,29H,6-7,13,15H2,1-5H3,(H2,30,31,32,34) |
| InChIKey | CFPQRBVHOWZTIX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|