C29H40ClN3O2 — CID 129294157
N-[N-[(Z)-4-(4-chlorophenyl)-6-methylnon-5-en-2-yl]-N'-(2-methylpropyl)carbamimidoyl]-3-methoxybenzamide (PubChem CID 129294157) has the molecular formula C29H40ClN3O2 and a molecular weight of 498.11 g/mol. Its IUPAC name is N-[N-[(Z)-4-(4-chlorophenyl)-6-methylnon-5-en-2-yl]-N'-(2-methylpropyl)carbamimidoyl]-3-methoxybenzamide.
| Compound Name | N-[N-[(Z)-4-(4-chlorophenyl)-6-methylnon-5-en-2-yl]-N'-(2-methylpropyl)carbamimidoyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 129294157 |
| Molecular Formula | C29H40ClN3O2 |
| Molecular Weight | 498.11 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | N-[N-[(Z)-4-(4-chlorophenyl)-6-methylnon-5-en-2-yl]-N'-(2-methylpropyl)carbamimidoyl]-3-methoxybenzamide |
| SMILES | CCC/C(C)=C\C(CC(C)N/C(=N\CC(C)C)NC(=O)c1cccc(OC)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H40ClN3O2/c1-7-9-21(4)16-25(23-12-14-26(30)15-13-23)17-22(5)32-29(31-19-20(2)3)33-28(34)24-10-8-11-27(18-24)35-6/h8,10-16,18,20,22,25H,7,9,17,19H2,1-6H3,(H2,31,32,33,34)/b21-16- |
| InChIKey | TZEQAMJNIGDOOO-PGMHBOJBSA-N |
| XLogP | 6.99 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.11 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|