C23H28ClF2N5O3 — CID 118376451
4-chloro-N-[N'-(2-ethoxypropyl)-N-[3-(4-fluorophenyl)-1-(methylamino)-3-nitrosopropyl]carbamimidoyl]-3-fluorobenzamide (PubChem CID 118376451) has the molecular formula C23H28ClF2N5O3 and a molecular weight of 495.96 g/mol. Its IUPAC name is 4-chloro-N-[N'-(2-ethoxypropyl)-N-[3-(4-fluorophenyl)-1-(methylamino)-3-nitrosopropyl]carbamimidoyl]-3-fluorobenzamide.
| Compound Name | 4-chloro-N-[N'-(2-ethoxypropyl)-N-[3-(4-fluorophenyl)-1-(methylamino)-3-nitrosopropyl]carbamimidoyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 118376451 |
| Molecular Formula | C23H28ClF2N5O3 |
| Molecular Weight | 495.96 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 4-chloro-N-[N'-(2-ethoxypropyl)-N-[3-(4-fluorophenyl)-1-(methylamino)-3-nitrosopropyl]carbamimidoyl]-3-fluorobenzamide |
| SMILES | CCOC(C)C/N=C(\NC(=O)c1ccc(Cl)c(F)c1)NC(CC(N=O)c1ccc(F)cc1)NC |
| InChI | InChI=1S/C23H28ClF2N5O3/c1-4-34-14(2)13-28-23(30-22(32)16-7-10-18(24)19(26)11-16)29-21(27-3)12-20(31-33)15-5-8-17(25)9-6-15/h5-11,14,20-21,27H,4,12-13H2,1-3H3,(H2,28,29,30,32) |
| InChIKey | OSOHYOATBXXLDC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.96 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|