C24H30FN5O3 — CID 118376349
N-[N'-cyclopentyl-N-[3-(4-fluorophenyl)-1-(methylamino)-3-nitrosopropyl]carbamimidoyl]-3-methoxybenzamide (PubChem CID 118376349) has the molecular formula C24H30FN5O3 and a molecular weight of 455.53 g/mol. Its IUPAC name is N-[N'-cyclopentyl-N-[3-(4-fluorophenyl)-1-(methylamino)-3-nitrosopropyl]carbamimidoyl]-3-methoxybenzamide.
| Compound Name | N-[N'-cyclopentyl-N-[3-(4-fluorophenyl)-1-(methylamino)-3-nitrosopropyl]carbamimidoyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 118376349 |
| Molecular Formula | C24H30FN5O3 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | N-[N'-cyclopentyl-N-[3-(4-fluorophenyl)-1-(methylamino)-3-nitrosopropyl]carbamimidoyl]-3-methoxybenzamide |
| SMILES | CNC(CC(N=O)c1ccc(F)cc1)N/C(=N\C1CCCC1)NC(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C24H30FN5O3/c1-26-22(15-21(30-32)16-10-12-18(25)13-11-16)28-24(27-19-7-3-4-8-19)29-23(31)17-6-5-9-20(14-17)33-2/h5-6,9-14,19,21-22,26H,3-4,7-8,15H2,1-2H3,(H2,27,28,29,31) |
| InChIKey | WVFAWWZDXLAKBN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|