C18H18FNO4 — CID 46860533
[2-[1-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3-methoxybenzoate (PubChem CID 46860533) has the molecular formula C18H18FNO4 and a molecular weight of 331.34 g/mol. Its IUPAC name is [2-[1-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3-methoxybenzoate.
| Compound Name | [2-[1-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 46860533 |
| Molecular Formula | C18H18FNO4 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | [2-[1-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)OCC(=O)NC(C)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H18FNO4/c1-12(13-6-8-15(19)9-7-13)20-17(21)11-24-18(22)14-4-3-5-16(10-14)23-2/h3-10,12H,11H2,1-2H3,(H,20,21) |
| InChIKey | ILESQUNBGOEGCJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |