C20H23NO4 — CID 50929606
[2-[1-(3-methoxyphenyl)ethylamino]-2-oxoethyl] 4-ethylbenzoate (PubChem CID 50929606) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is [2-[1-(3-methoxyphenyl)ethylamino]-2-oxoethyl] 4-ethylbenzoate.
| Compound Name | [2-[1-(3-methoxyphenyl)ethylamino]-2-oxoethyl] 4-ethylbenzoate |
|---|---|
| PubChem CID | 50929606 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | [2-[1-(3-methoxyphenyl)ethylamino]-2-oxoethyl] 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)OCC(=O)NC(C)c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C20H23NO4/c1-4-15-8-10-16(11-9-15)20(23)25-13-19(22)21-14(2)17-6-5-7-18(12-17)24-3/h5-12,14H,4,13H2,1-3H3,(H,21,22) |
| InChIKey | LJDJUZBWXRPIPF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |