C20H22N2O5 — CID 95181203
[2-[[(1R)-1-(3-methoxyphenyl)ethyl]amino]-2-oxoethyl] 4-acetamidobenzoate (PubChem CID 95181203) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is [2-[[(1R)-1-(3-methoxyphenyl)ethyl]amino]-2-oxoethyl] 4-acetamidobenzoate.
| Compound Name | [2-[[(1R)-1-(3-methoxyphenyl)ethyl]amino]-2-oxoethyl] 4-acetamidobenzoate |
|---|---|
| PubChem CID | 95181203 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | [2-[[(1R)-1-(3-methoxyphenyl)ethyl]amino]-2-oxoethyl] 4-acetamidobenzoate |
| SMILES | COc1cccc([C@@H](C)NC(=O)COC(=O)c2ccc(NC(C)=O)cc2)c1 |
| InChI | InChI=1S/C20H22N2O5/c1-13(16-5-4-6-18(11-16)26-3)21-19(24)12-27-20(25)15-7-9-17(10-8-15)22-14(2)23/h4-11,13H,12H2,1-3H3,(H,21,24)(H,22,23)/t13-/m1/s1 |
| InChIKey | JYEGBZZFGVEPLZ-CYBMUJFWSA-N |
| XLogP | 2.69 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |