C19H20N2O4 — CID 7654320
[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 4-acetamidobenzoate (PubChem CID 7654320) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 4-acetamidobenzoate.
| Compound Name | [2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 4-acetamidobenzoate |
|---|---|
| PubChem CID | 7654320 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 4-acetamidobenzoate |
| SMILES | CC(=O)Nc1ccc(C(=O)OCC(=O)N[C@@H](C)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H20N2O4/c1-13(15-6-4-3-5-7-15)20-18(23)12-25-19(24)16-8-10-17(11-9-16)21-14(2)22/h3-11,13H,12H2,1-2H3,(H,20,23)(H,21,22)/t13-/m0/s1 |
| InChIKey | OJKFYONUBVDEBI-ZDUSSCGKSA-N |
| XLogP | 2.68 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |