C23H24FN3O2 — CID 4266674
N-cyclohexyl-1-(4-fluorophenyl)-3-(3-methoxyphenyl)pyrazole-5-carboxamide (PubChem CID 4266674) has the molecular formula C23H24FN3O2 and a molecular weight of 393.46 g/mol. Its IUPAC name is N-cyclohexyl-1-(4-fluorophenyl)-3-(3-methoxyphenyl)pyrazole-5-carboxamide.
| Compound Name | N-cyclohexyl-1-(4-fluorophenyl)-3-(3-methoxyphenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4266674 |
| Molecular Formula | C23H24FN3O2 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | N-cyclohexyl-1-(4-fluorophenyl)-3-(3-methoxyphenyl)pyrazole-5-carboxamide |
| SMILES | COc1cccc(-c2cc(C(=O)NC3CCCCC3)n(-c3ccc(F)cc3)n2)c1 |
| InChI | InChI=1S/C23H24FN3O2/c1-29-20-9-5-6-16(14-20)21-15-22(23(28)25-18-7-3-2-4-8-18)27(26-21)19-12-10-17(24)11-13-19/h5-6,9-15,18H,2-4,7-8H2,1H3,(H,25,28) |
| InChIKey | OIHOTWBBLYZMOT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |