C26H29N3O5 — CID 118736193
ethyl 3-[3-(cyclohexylcarbamoyloxy)phenyl]-1-(4-methoxyphenyl)pyrazole-5-carboxylate (PubChem CID 118736193) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is ethyl 3-[3-(cyclohexylcarbamoyloxy)phenyl]-1-(4-methoxyphenyl)pyrazole-5-carboxylate.
| Compound Name | ethyl 3-[3-(cyclohexylcarbamoyloxy)phenyl]-1-(4-methoxyphenyl)pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 118736193 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | ethyl 3-[3-(cyclohexylcarbamoyloxy)phenyl]-1-(4-methoxyphenyl)pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cccc(OC(=O)NC3CCCCC3)c2)nn1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H29N3O5/c1-3-33-25(30)24-17-23(28-29(24)20-12-14-21(32-2)15-13-20)18-8-7-11-22(16-18)34-26(31)27-19-9-5-4-6-10-19/h7-8,11-17,19H,3-6,9-10H2,1-2H3,(H,27,31) |
| InChIKey | KRFJUCACILOBNA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |