C16H18N2O3 — CID 69173921
[3-(1,3-oxazol-4-yl)phenyl] N-cyclohexylcarbamate (PubChem CID 69173921) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is [3-(1,3-oxazol-4-yl)phenyl] N-cyclohexylcarbamate.
| Compound Name | [3-(1,3-oxazol-4-yl)phenyl] N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 69173921 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | [3-(1,3-oxazol-4-yl)phenyl] N-cyclohexylcarbamate |
| SMILES | O=C(NC1CCCCC1)Oc1cccc(-c2cocn2)c1 |
| InChI | InChI=1S/C16H18N2O3/c19-16(18-13-6-2-1-3-7-13)21-14-8-4-5-12(9-14)15-10-20-11-17-15/h4-5,8-11,13H,1-3,6-7H2,(H,18,19) |
| InChIKey | RGDGQDPDGSDNDG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |