C23H26FNO4 — CID 90036113
methyl 2-[4-[3-(cyclohexylcarbamoyloxy)phenyl]-3-fluorophenyl]propanoate (PubChem CID 90036113) has the molecular formula C23H26FNO4 and a molecular weight of 399.46 g/mol. Its IUPAC name is methyl 2-[4-[3-(cyclohexylcarbamoyloxy)phenyl]-3-fluorophenyl]propanoate.
| Compound Name | methyl 2-[4-[3-(cyclohexylcarbamoyloxy)phenyl]-3-fluorophenyl]propanoate |
|---|---|
| PubChem CID | 90036113 |
| Molecular Formula | C23H26FNO4 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | methyl 2-[4-[3-(cyclohexylcarbamoyloxy)phenyl]-3-fluorophenyl]propanoate |
| SMILES | COC(=O)C(C)c1ccc(-c2cccc(OC(=O)NC3CCCCC3)c2)c(F)c1 |
| InChI | InChI=1S/C23H26FNO4/c1-15(22(26)28-2)16-11-12-20(21(24)14-16)17-7-6-10-19(13-17)29-23(27)25-18-8-4-3-5-9-18/h6-7,10-15,18H,3-5,8-9H2,1-2H3,(H,25,27) |
| InChIKey | JQGLJGXWAKZKIT-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |