C24H28FNO4 — CID 73054546
2-[4-[3-(2-cyclohexylethylcarbamoyloxy)phenyl]-3-fluorophenyl]propanoic acid (PubChem CID 73054546) has the molecular formula C24H28FNO4 and a molecular weight of 413.49 g/mol. Its IUPAC name is 2-[4-[3-(2-cyclohexylethylcarbamoyloxy)phenyl]-3-fluorophenyl]propanoic acid.
| Compound Name | 2-[4-[3-(2-cyclohexylethylcarbamoyloxy)phenyl]-3-fluorophenyl]propanoic acid |
|---|---|
| PubChem CID | 73054546 |
| Molecular Formula | C24H28FNO4 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 2-[4-[3-(2-cyclohexylethylcarbamoyloxy)phenyl]-3-fluorophenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(-c2cccc(OC(=O)NCCC3CCCCC3)c2)c(F)c1 |
| InChI | InChI=1S/C24H28FNO4/c1-16(23(27)28)18-10-11-21(22(25)15-18)19-8-5-9-20(14-19)30-24(29)26-13-12-17-6-3-2-4-7-17/h5,8-11,14-17H,2-4,6-7,12-13H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | HVZWYUCURZIENB-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |