About (3-methylphenyl) N-(cyclopentylmethyl)carbamate
(3-methylphenyl) N-(cyclopentylmethyl)carbamate (PubChem CID 141077229) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is (3-methylphenyl) N-(cyclopentylmethyl)carbamate.
Molecular Properties
| Compound Name | (3-methylphenyl) N-(cyclopentylmethyl)carbamate |
| PubChem CID | 141077229 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (3-methylphenyl) N-(cyclopentylmethyl)carbamate |
| SMILES | Cc1cccc(OC(=O)NCC2CCCC2)c1 |
| InChI | InChI=1S/C14H19NO2/c1-11-5-4-8-13(9-11)17-14(16)15-10-12-6-2-3-7-12/h4-5,8-9,12H,2-3,6-7,10H2,1H3,(H,15,16) |
| InChIKey | FKBCTOOZUMGPGJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-methylphenyl) N-(cyclopentylmethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylphenyl) N-(cyclopentylmethyl)carbamate?
The IUPAC name of (3-methylphenyl) N-(cyclopentylmethyl)carbamate (CID 141077229) is (3-methylphenyl) N-(cyclopentylmethyl)carbamate.
What is the SMILES notation for (3-methylphenyl) N-(cyclopentylmethyl)carbamate?
The canonical SMILES for (3-methylphenyl) N-(cyclopentylmethyl)carbamate is Cc1cccc(OC(=O)NCC2CCCC2)c1.
What is the InChIKey of (3-methylphenyl) N-(cyclopentylmethyl)carbamate?
The InChIKey is FKBCTOOZUMGPGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2/c1-11-5-4-8-13(9-11)17-14(16)15-10-12-6-2-3-7-12/h4-5,8-9,12H,2-3,6-7,10H2,1H3,(H,15,16).
What are the key properties of (3-methylphenyl) N-(cyclopentylmethyl)carbamate?
(3-methylphenyl) N-(cyclopentylmethyl)carbamate has a molecular weight of 233.31 g/mol, XLogP of 3.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylphenyl) N-(cyclopentylmethyl)carbamate is sourced from PubChem (CID 141077229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).