C14H19NO2 — CID 141077229
(3-methylphenyl) N-(cyclopentylmethyl)carbamate (PubChem CID 141077229) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (3-methylphenyl) N-(cyclopentylmethyl)carbamate.
| Compound Name | (3-methylphenyl) N-(cyclopentylmethyl)carbamate |
|---|---|
| PubChem CID | 141077229 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (3-methylphenyl) N-(cyclopentylmethyl)carbamate |
| SMILES | Cc1cccc(OC(=O)NCC2CCCC2)c1 |
| InChI | InChI=1S/C14H19NO2/c1-11-5-4-8-13(9-11)17-14(16)15-10-12-6-2-3-7-12/h4-5,8-9,12H,2-3,6-7,10H2,1H3,(H,15,16) |
| InChIKey | FKBCTOOZUMGPGJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |