C17H24ClNO2 — CID 106131941
N-[(3-chlorocyclohexyl)methyl]-3-(3-methylphenoxy)propanamide (PubChem CID 106131941) has the molecular formula C17H24ClNO2 and a molecular weight of 309.84 g/mol. Its IUPAC name is N-[(3-chlorocyclohexyl)methyl]-3-(3-methylphenoxy)propanamide.
| Compound Name | N-[(3-chlorocyclohexyl)methyl]-3-(3-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 106131941 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N-[(3-chlorocyclohexyl)methyl]-3-(3-methylphenoxy)propanamide |
| SMILES | Cc1cccc(OCCC(=O)NCC2CCCC(Cl)C2)c1 |
| InChI | InChI=1S/C17H24ClNO2/c1-13-4-2-7-16(10-13)21-9-8-17(20)19-12-14-5-3-6-15(18)11-14/h2,4,7,10,14-15H,3,5-6,8-9,11-12H2,1H3,(H,19,20) |
| InChIKey | PFVICWLPMVSSDG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|