C25H23FO4 — CID 148875108
2-[3-fluoro-4-[3-(4-phenylbutanoyloxy)phenyl]phenyl]propanoic acid (PubChem CID 148875108) has the molecular formula C25H23FO4 and a molecular weight of 406.45 g/mol. Its IUPAC name is 2-[3-fluoro-4-[3-(4-phenylbutanoyloxy)phenyl]phenyl]propanoic acid.
| Compound Name | 2-[3-fluoro-4-[3-(4-phenylbutanoyloxy)phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 148875108 |
| Molecular Formula | C25H23FO4 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 2-[3-fluoro-4-[3-(4-phenylbutanoyloxy)phenyl]phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(-c2cccc(OC(=O)CCCc3ccccc3)c2)c(F)c1 |
| InChI | InChI=1S/C25H23FO4/c1-17(25(28)29)19-13-14-22(23(26)16-19)20-10-6-11-21(15-20)30-24(27)12-5-9-18-7-3-2-4-8-18/h2-4,6-8,10-11,13-17H,5,9,12H2,1H3,(H,28,29) |
| InChIKey | PBYIWUQPRDURPC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|