C16H19N3O3 — CID 69174143
[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] N-cyclohexylcarbamate (PubChem CID 69174143) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is [3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] N-cyclohexylcarbamate.
| Compound Name | [3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 69174143 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | [3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] N-cyclohexylcarbamate |
| SMILES | Cc1nc(-c2cccc(OC(=O)NC3CCCCC3)c2)no1 |
| InChI | InChI=1S/C16H19N3O3/c1-11-17-15(19-22-11)12-6-5-9-14(10-12)21-16(20)18-13-7-3-2-4-8-13/h5-6,9-10,13H,2-4,7-8H2,1H3,(H,18,20) |
| InChIKey | JRIKSMQDDYEEAX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |