C25H27N3O4 — CID 118736191
ethyl 3-[3-(cyclohexylcarbamoyloxy)phenyl]-1-phenylpyrazole-5-carboxylate (PubChem CID 118736191) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is ethyl 3-[3-(cyclohexylcarbamoyloxy)phenyl]-1-phenylpyrazole-5-carboxylate.
| Compound Name | ethyl 3-[3-(cyclohexylcarbamoyloxy)phenyl]-1-phenylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 118736191 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | ethyl 3-[3-(cyclohexylcarbamoyloxy)phenyl]-1-phenylpyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cccc(OC(=O)NC3CCCCC3)c2)nn1-c1ccccc1 |
| InChI | InChI=1S/C25H27N3O4/c1-2-31-24(29)23-17-22(27-28(23)20-13-7-4-8-14-20)18-10-9-15-21(16-18)32-25(30)26-19-11-5-3-6-12-19/h4,7-10,13-17,19H,2-3,5-6,11-12H2,1H3,(H,26,30) |
| InChIKey | PRDVWVSICHPQRU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |