C20H25N3O4 — CID 118736176
ethyl 5-[4-(cyclohexylcarbamoyloxy)phenyl]-1-methylpyrazole-3-carboxylate (PubChem CID 118736176) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is ethyl 5-[4-(cyclohexylcarbamoyloxy)phenyl]-1-methylpyrazole-3-carboxylate.
| Compound Name | ethyl 5-[4-(cyclohexylcarbamoyloxy)phenyl]-1-methylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 118736176 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | ethyl 5-[4-(cyclohexylcarbamoyloxy)phenyl]-1-methylpyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(OC(=O)NC3CCCCC3)cc2)n(C)n1 |
| InChI | InChI=1S/C20H25N3O4/c1-3-26-19(24)17-13-18(23(2)22-17)14-9-11-16(12-10-14)27-20(25)21-15-7-5-4-6-8-15/h9-13,15H,3-8H2,1-2H3,(H,21,25) |
| InChIKey | HXKMPMGDDRQWJU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |