C13H12F2N2O2 — CID 42878867
ethyl 5-(3,4-difluorophenyl)-1-methylpyrazole-3-carboxylate (PubChem CID 42878867) has the molecular formula C13H12F2N2O2 and a molecular weight of 266.25 g/mol. Its IUPAC name is ethyl 5-(3,4-difluorophenyl)-1-methylpyrazole-3-carboxylate.
| Compound Name | ethyl 5-(3,4-difluorophenyl)-1-methylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 42878867 |
| Molecular Formula | C13H12F2N2O2 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | ethyl 5-(3,4-difluorophenyl)-1-methylpyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(F)c(F)c2)n(C)n1 |
| InChI | InChI=1S/C13H12F2N2O2/c1-3-19-13(18)11-7-12(17(2)16-11)8-4-5-9(14)10(15)6-8/h4-7H,3H2,1-2H3 |
| InChIKey | RLMVXLXWCANZJW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |