C30H32N4O2 — CID 3882518
N-(1-benzylpiperidin-4-yl)-3-(3-methoxyphenyl)-1-(3-methylphenyl)pyrazole-5-carboxamide (PubChem CID 3882518) has the molecular formula C30H32N4O2 and a molecular weight of 480.61 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-3-(3-methoxyphenyl)-1-(3-methylphenyl)pyrazole-5-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-3-(3-methoxyphenyl)-1-(3-methylphenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3882518 |
| Molecular Formula | C30H32N4O2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-3-(3-methoxyphenyl)-1-(3-methylphenyl)pyrazole-5-carboxamide |
| SMILES | COc1cccc(-c2cc(C(=O)NC3CCN(Cc4ccccc4)CC3)n(-c3cccc(C)c3)n2)c1 |
| InChI | InChI=1S/C30H32N4O2/c1-22-8-6-12-26(18-22)34-29(20-28(32-34)24-11-7-13-27(19-24)36-2)30(35)31-25-14-16-33(17-15-25)21-23-9-4-3-5-10-23/h3-13,18-20,25H,14-17,21H2,1-2H3,(H,31,35) |
| InChIKey | MEDGMBUZUBJOHH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |