C24H25F3N4O2 — CID 10310621
N-(1-benzylpiperidin-4-yl)-1-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 10310621) has the molecular formula C24H25F3N4O2 and a molecular weight of 458.48 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-1-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-1-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 10310621 |
| Molecular Formula | C24H25F3N4O2 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-1-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | COc1ccc(-n2nc(C(F)(F)F)cc2C(=O)NC2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H25F3N4O2/c1-33-20-9-7-19(8-10-20)31-21(15-22(29-31)24(25,26)27)23(32)28-18-11-13-30(14-12-18)16-17-5-3-2-4-6-17/h2-10,15,18H,11-14,16H2,1H3,(H,28,32) |
| InChIKey | LQYNYIOBPAZTIR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |