C25H39FN6O2 — CID 118102197
4-tert-butyl-N-[N'-cyclopentyl-N-[3-(4-fluorophenyl)-1-(methylamino)-3-nitrosopropyl]carbamimidoyl]-1-methylazetidine-2-carboxamide (PubChem CID 118102197) has the molecular formula C25H39FN6O2 and a molecular weight of 474.63 g/mol. Its IUPAC name is 4-tert-butyl-N-[N'-cyclopentyl-N-[3-(4-fluorophenyl)-1-(methylamino)-3-nitrosopropyl]carbamimidoyl]-1-methylazetidine-2-carboxamide.
| Compound Name | 4-tert-butyl-N-[N'-cyclopentyl-N-[3-(4-fluorophenyl)-1-(methylamino)-3-nitrosopropyl]carbamimidoyl]-1-methylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 118102197 |
| Molecular Formula | C25H39FN6O2 |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | 4-tert-butyl-N-[N'-cyclopentyl-N-[3-(4-fluorophenyl)-1-(methylamino)-3-nitrosopropyl]carbamimidoyl]-1-methylazetidine-2-carboxamide |
| SMILES | CNC(CC(N=O)c1ccc(F)cc1)N/C(=N/C1CCCC1)NC(=O)C1CC(C(C)(C)C)N1C |
| InChI | InChI=1S/C25H39FN6O2/c1-25(2,3)21-15-20(32(21)5)23(33)30-24(28-18-8-6-7-9-18)29-22(27-4)14-19(31-34)16-10-12-17(26)13-11-16/h10-13,18-22,27H,6-9,14-15H2,1-5H3,(H2,28,29,30,33) |
| InChIKey | GGDAXOHHLGPZOY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|