C24H31FN2O3 — CID 122586535
3-[3-(4-fluoroanilino)-4-[2-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]phenyl]pentanoic acid (PubChem CID 122586535) has the molecular formula C24H31FN2O3 and a molecular weight of 414.52 g/mol. Its IUPAC name is 3-[3-(4-fluoroanilino)-4-[2-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]phenyl]pentanoic acid.
| Compound Name | 3-[3-(4-fluoroanilino)-4-[2-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 122586535 |
| Molecular Formula | C24H31FN2O3 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 3-[3-(4-fluoroanilino)-4-[2-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]phenyl]pentanoic acid |
| SMILES | CCC(CC(=O)O)c1ccc(N2CCCC2C(C)(C)O)c(Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C24H31FN2O3/c1-4-16(15-23(28)29)17-7-12-21(27-13-5-6-22(27)24(2,3)30)20(14-17)26-19-10-8-18(25)9-11-19/h7-12,14,16,22,26,30H,4-6,13,15H2,1-3H3,(H,28,29) |
| InChIKey | GKWUPEQQVBGNEP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |