C19H30N2O3 — CID 122587601
methyl 3-[3-amino-4-[(2S)-2-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]phenyl]pentanoate (PubChem CID 122587601) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is methyl 3-[3-amino-4-[(2S)-2-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]phenyl]pentanoate.
| Compound Name | methyl 3-[3-amino-4-[(2S)-2-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]phenyl]pentanoate |
|---|---|
| PubChem CID | 122587601 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | methyl 3-[3-amino-4-[(2S)-2-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]phenyl]pentanoate |
| SMILES | CCC(CC(=O)OC)c1ccc(N2CCC[C@H]2C(C)(C)O)c(N)c1 |
| InChI | InChI=1S/C19H30N2O3/c1-5-13(12-18(22)24-4)14-8-9-16(15(20)11-14)21-10-6-7-17(21)19(2,3)23/h8-9,11,13,17,23H,5-7,10,12,20H2,1-4H3/t13?,17-/m0/s1 |
| InChIKey | SOTAEUSSGSLDEG-RUINGEJQSA-N |
| XLogP | 3.07 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|