C21H36N2O3 — CID 122586806
methyl 3-[3-amino-4-[(2-hydroxy-2-methylbutyl)-(2-methylpropyl)amino]phenyl]pentanoate (PubChem CID 122586806) has the molecular formula C21H36N2O3 and a molecular weight of 364.53 g/mol. Its IUPAC name is methyl 3-[3-amino-4-[(2-hydroxy-2-methylbutyl)-(2-methylpropyl)amino]phenyl]pentanoate.
| Compound Name | methyl 3-[3-amino-4-[(2-hydroxy-2-methylbutyl)-(2-methylpropyl)amino]phenyl]pentanoate |
|---|---|
| PubChem CID | 122586806 |
| Molecular Formula | C21H36N2O3 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.27 |
| IUPAC Name | methyl 3-[3-amino-4-[(2-hydroxy-2-methylbutyl)-(2-methylpropyl)amino]phenyl]pentanoate |
| SMILES | CCC(CC(=O)OC)c1ccc(N(CC(C)C)CC(C)(O)CC)c(N)c1 |
| InChI | InChI=1S/C21H36N2O3/c1-7-16(12-20(24)26-6)17-9-10-19(18(22)11-17)23(13-15(3)4)14-21(5,25)8-2/h9-11,15-16,25H,7-8,12-14,22H2,1-6H3 |
| InChIKey | HTGNIACDUVRSOW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|