C20H31F3N2O2 — CID 90464891
ethyl 3-[3-amino-4-[bis(2-methylpropyl)amino]phenyl]-4,4,4-trifluorobutanoate (PubChem CID 90464891) has the molecular formula C20H31F3N2O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is ethyl 3-[3-amino-4-[bis(2-methylpropyl)amino]phenyl]-4,4,4-trifluorobutanoate.
| Compound Name | ethyl 3-[3-amino-4-[bis(2-methylpropyl)amino]phenyl]-4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 90464891 |
| Molecular Formula | C20H31F3N2O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | ethyl 3-[3-amino-4-[bis(2-methylpropyl)amino]phenyl]-4,4,4-trifluorobutanoate |
| SMILES | CCOC(=O)CC(c1ccc(N(CC(C)C)CC(C)C)c(N)c1)C(F)(F)F |
| InChI | InChI=1S/C20H31F3N2O2/c1-6-27-19(26)10-16(20(21,22)23)15-7-8-18(17(24)9-15)25(11-13(2)3)12-14(4)5/h7-9,13-14,16H,6,10-12,24H2,1-5H3 |
| InChIKey | URQNPSGCKOLMCL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|