C22H36N2O2 — CID 126727432
ethyl (3S)-3-[3-amino-4-[cyclohexyl(2-methylpropyl)amino]phenyl]butanoate (PubChem CID 126727432) has the molecular formula C22H36N2O2 and a molecular weight of 360.54 g/mol. Its IUPAC name is ethyl (3S)-3-[3-amino-4-[cyclohexyl(2-methylpropyl)amino]phenyl]butanoate.
| Compound Name | ethyl (3S)-3-[3-amino-4-[cyclohexyl(2-methylpropyl)amino]phenyl]butanoate |
|---|---|
| PubChem CID | 126727432 |
| Molecular Formula | C22H36N2O2 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | ethyl (3S)-3-[3-amino-4-[cyclohexyl(2-methylpropyl)amino]phenyl]butanoate |
| SMILES | CCOC(=O)C[C@H](C)c1ccc(N(CC(C)C)C2CCCCC2)c(N)c1 |
| InChI | InChI=1S/C22H36N2O2/c1-5-26-22(25)13-17(4)18-11-12-21(20(23)14-18)24(15-16(2)3)19-9-7-6-8-10-19/h11-12,14,16-17,19H,5-10,13,15,23H2,1-4H3/t17-/m0/s1 |
| InChIKey | KGUFCRLUTFUSAY-KRWDZBQOSA-N |
| XLogP | 5.12 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|