C23H37N3O4 — CID 135153174
(3R)-3-[3-amino-4-[[1-(3-methoxypropanoyl)piperidin-4-yl]-(2-methylpropyl)amino]phenyl]butanoic acid (PubChem CID 135153174) has the molecular formula C23H37N3O4 and a molecular weight of 419.57 g/mol. Its IUPAC name is (3R)-3-[3-amino-4-[[1-(3-methoxypropanoyl)piperidin-4-yl]-(2-methylpropyl)amino]phenyl]butanoic acid.
| Compound Name | (3R)-3-[3-amino-4-[[1-(3-methoxypropanoyl)piperidin-4-yl]-(2-methylpropyl)amino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 135153174 |
| Molecular Formula | C23H37N3O4 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | (3R)-3-[3-amino-4-[[1-(3-methoxypropanoyl)piperidin-4-yl]-(2-methylpropyl)amino]phenyl]butanoic acid |
| SMILES | COCCC(=O)N1CCC(N(CC(C)C)c2ccc([C@H](C)CC(=O)O)cc2N)CC1 |
| InChI | InChI=1S/C23H37N3O4/c1-16(2)15-26(19-7-10-25(11-8-19)22(27)9-12-30-4)21-6-5-18(14-20(21)24)17(3)13-23(28)29/h5-6,14,16-17,19H,7-13,15,24H2,1-4H3,(H,28,29)/t17-/m1/s1 |
| InChIKey | WRGAZBJDBFCOOU-QGZVFWFLSA-N |
| XLogP | 3.34 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|