C21H33N3O2S — CID 126722275
3-[3-(carbamothioylamino)-4-[cyclohexyl(2-methylpropyl)amino]phenyl]butanoic acid (PubChem CID 126722275) has the molecular formula C21H33N3O2S and a molecular weight of 391.58 g/mol. Its IUPAC name is 3-[3-(carbamothioylamino)-4-[cyclohexyl(2-methylpropyl)amino]phenyl]butanoic acid.
| Compound Name | 3-[3-(carbamothioylamino)-4-[cyclohexyl(2-methylpropyl)amino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 126722275 |
| Molecular Formula | C21H33N3O2S |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 3-[3-(carbamothioylamino)-4-[cyclohexyl(2-methylpropyl)amino]phenyl]butanoic acid |
| SMILES | CC(C)CN(c1ccc(C(C)CC(=O)O)cc1NC(N)=S)C1CCCCC1 |
| InChI | InChI=1S/C21H33N3O2S/c1-14(2)13-24(17-7-5-4-6-8-17)19-10-9-16(15(3)11-20(25)26)12-18(19)23-21(22)27/h9-10,12,14-15,17H,4-8,11,13H2,1-3H3,(H,25,26)(H3,22,23,27) |
| InChIKey | CCVCUTPQGIPSPA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|