C21H35N3O2 — CID 142383706
ethyl (3R)-3-[5-amino-6-[cyclohexyl(2-methylpropyl)amino]-3-pyridinyl]butanoate (PubChem CID 142383706) has the molecular formula C21H35N3O2 and a molecular weight of 361.53 g/mol. Its IUPAC name is ethyl (3R)-3-[5-amino-6-[cyclohexyl(2-methylpropyl)amino]-3-pyridinyl]butanoate.
| Compound Name | ethyl (3R)-3-[5-amino-6-[cyclohexyl(2-methylpropyl)amino]-3-pyridinyl]butanoate |
|---|---|
| PubChem CID | 142383706 |
| Molecular Formula | C21H35N3O2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.27 |
| IUPAC Name | ethyl (3R)-3-[5-amino-6-[cyclohexyl(2-methylpropyl)amino]-3-pyridinyl]butanoate |
| SMILES | CCOC(=O)C[C@@H](C)c1cnc(N(CC(C)C)C2CCCCC2)c(N)c1 |
| InChI | InChI=1S/C21H35N3O2/c1-5-26-20(25)11-16(4)17-12-19(22)21(23-13-17)24(14-15(2)3)18-9-7-6-8-10-18/h12-13,15-16,18H,5-11,14,22H2,1-4H3/t16-/m1/s1 |
| InChIKey | PTQLVCBXQUJYJV-MRXNPFEDSA-N |
| XLogP | 4.52 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |