C21H35N3O3 — CID 142509439
1-[5-amino-6-[2-methylpropyl(oxan-4-yl)amino]-3-pyridinyl]cyclopropane-1-carbaldehyde;methoxyethane (PubChem CID 142509439) has the molecular formula C21H35N3O3 and a molecular weight of 377.53 g/mol. Its IUPAC name is 1-[5-amino-6-[2-methylpropyl(oxan-4-yl)amino]-3-pyridinyl]cyclopropane-1-carbaldehyde;methoxyethane.
| Compound Name | 1-[5-amino-6-[2-methylpropyl(oxan-4-yl)amino]-3-pyridinyl]cyclopropane-1-carbaldehyde;methoxyethane |
|---|---|
| PubChem CID | 142509439 |
| Molecular Formula | C21H35N3O3 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | 1-[5-amino-6-[2-methylpropyl(oxan-4-yl)amino]-3-pyridinyl]cyclopropane-1-carbaldehyde;methoxyethane |
| SMILES | CC(C)CN(c1ncc(C2(C=O)CC2)cc1N)C1CCOCC1.CCOC |
| InChI | InChI=1S/C18H27N3O2.C3H8O/c1-13(2)11-21(15-3-7-23-8-4-15)17-16(19)9-14(10-20-17)18(12-22)5-6-18;1-3-4-2/h9-10,12-13,15H,3-8,11,19H2,1-2H3;3H2,1-2H3 |
| InChIKey | XFWXVHJGKYWQAT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|