C26H39N5O3S — CID 142509418
1-[3-[(2-methoxypyrimidin-5-yl)amino]-4-[2-methylpropyl(oxan-4-yl)amino]phenyl]cyclopropane-1-carbaldehyde;N-methylsulfanylmethanamine (PubChem CID 142509418) has the molecular formula C26H39N5O3S and a molecular weight of 501.70 g/mol. Its IUPAC name is 1-[3-[(2-methoxypyrimidin-5-yl)amino]-4-[2-methylpropyl(oxan-4-yl)amino]phenyl]cyclopropane-1-carbaldehyde;N-methylsulfanylmethanamine.
| Compound Name | 1-[3-[(2-methoxypyrimidin-5-yl)amino]-4-[2-methylpropyl(oxan-4-yl)amino]phenyl]cyclopropane-1-carbaldehyde;N-methylsulfanylmethanamine |
|---|---|
| PubChem CID | 142509418 |
| Molecular Formula | C26H39N5O3S |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 501.28 |
| IUPAC Name | 1-[3-[(2-methoxypyrimidin-5-yl)amino]-4-[2-methylpropyl(oxan-4-yl)amino]phenyl]cyclopropane-1-carbaldehyde;N-methylsulfanylmethanamine |
| SMILES | CNSC.COc1ncc(Nc2cc(C3(C=O)CC3)ccc2N(CC(C)C)C2CCOCC2)cn1 |
| InChI | InChI=1S/C24H32N4O3.C2H7NS/c1-17(2)15-28(20-6-10-31-11-7-20)22-5-4-18(24(16-29)8-9-24)12-21(22)27-19-13-25-23(30-3)26-14-19;1-3-4-2/h4-5,12-14,16-17,20,27H,6-11,15H2,1-3H3;3H,1-2H3 |
| InChIKey | VMAIQJHXSIYRLR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.70 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|