C26H32ClFN2O3 — CID 153448562
[1-[3-(4-chloro-2-fluoroanilino)-4-[2-methylpropyl(oxan-4-yl)amino]phenyl]cyclobutyl] formate (PubChem CID 153448562) has the molecular formula C26H32ClFN2O3 and a molecular weight of 475.00 g/mol. Its IUPAC name is [1-[3-(4-chloro-2-fluoroanilino)-4-[2-methylpropyl(oxan-4-yl)amino]phenyl]cyclobutyl] formate.
| Compound Name | [1-[3-(4-chloro-2-fluoroanilino)-4-[2-methylpropyl(oxan-4-yl)amino]phenyl]cyclobutyl] formate |
|---|---|
| PubChem CID | 153448562 |
| Molecular Formula | C26H32ClFN2O3 |
| Molecular Weight | 475.00 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | [1-[3-(4-chloro-2-fluoroanilino)-4-[2-methylpropyl(oxan-4-yl)amino]phenyl]cyclobutyl] formate |
| SMILES | CC(C)CN(c1ccc(C2(OC=O)CCC2)cc1Nc1ccc(Cl)cc1F)C1CCOCC1 |
| InChI | InChI=1S/C26H32ClFN2O3/c1-18(2)16-30(21-8-12-32-13-9-21)25-7-4-19(26(33-17-31)10-3-11-26)14-24(25)29-23-6-5-20(27)15-22(23)28/h4-7,14-15,17-18,21,29H,3,8-13,16H2,1-2H3 |
| InChIKey | CLRGRQGSRMJSHM-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.00 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|