C25H36ClN5O2S — CID 142509438
2-N-(5-chloro-2-pyridinyl)-6-(1-methylcyclopropyl)-3-N-(2-methylpropyl)-3-N-(oxan-4-yl)pyridine-2,3-diamine;N-methylsulfanylformamide (PubChem CID 142509438) has the molecular formula C25H36ClN5O2S and a molecular weight of 506.12 g/mol. Its IUPAC name is 2-N-(5-chloro-2-pyridinyl)-6-(1-methylcyclopropyl)-3-N-(2-methylpropyl)-3-N-(oxan-4-yl)pyridine-2,3-diamine;N-methylsulfanylformamide.
| Compound Name | 2-N-(5-chloro-2-pyridinyl)-6-(1-methylcyclopropyl)-3-N-(2-methylpropyl)-3-N-(oxan-4-yl)pyridine-2,3-diamine;N-methylsulfanylformamide |
|---|---|
| PubChem CID | 142509438 |
| Molecular Formula | C25H36ClN5O2S |
| Molecular Weight | 506.12 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | 2-N-(5-chloro-2-pyridinyl)-6-(1-methylcyclopropyl)-3-N-(2-methylpropyl)-3-N-(oxan-4-yl)pyridine-2,3-diamine;N-methylsulfanylformamide |
| SMILES | CC(C)CN(c1ccc(C2(C)CC2)nc1Nc1ccc(Cl)cn1)C1CCOCC1.CSNC=O |
| InChI | InChI=1S/C23H31ClN4O.C2H5NOS/c1-16(2)15-28(18-8-12-29-13-9-18)19-5-6-20(23(3)10-11-23)26-22(19)27-21-7-4-17(24)14-25-21;1-5-3-2-4/h4-7,14,16,18H,8-13,15H2,1-3H3,(H,25,26,27);2H,1H3,(H,3,4) |
| InChIKey | QPDNLJVQHDTFCP-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.12 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|