C20H34N2O4S — CID 122586517
methyl 3-[3-amino-4-[(1,1-dihydroxythian-4-yl)-propylamino]phenyl]pentanoate (PubChem CID 122586517) has the molecular formula C20H34N2O4S and a molecular weight of 398.57 g/mol. Its IUPAC name is methyl 3-[3-amino-4-[(1,1-dihydroxythian-4-yl)-propylamino]phenyl]pentanoate.
| Compound Name | methyl 3-[3-amino-4-[(1,1-dihydroxythian-4-yl)-propylamino]phenyl]pentanoate |
|---|---|
| PubChem CID | 122586517 |
| Molecular Formula | C20H34N2O4S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | methyl 3-[3-amino-4-[(1,1-dihydroxythian-4-yl)-propylamino]phenyl]pentanoate |
| SMILES | CCCN(c1ccc(C(CC)CC(=O)OC)cc1N)C1CCS(O)(O)CC1 |
| InChI | InChI=1S/C20H34N2O4S/c1-4-10-22(17-8-11-27(24,25)12-9-17)19-7-6-16(13-18(19)21)15(5-2)14-20(23)26-3/h6-7,13,15,17,24-25H,4-5,8-12,14,21H2,1-3H3 |
| InChIKey | YFTOGSUIRZKBHW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|