C20H30N2O6S — CID 122586229
methyl 3-cyclopropyl-3-[4-[(1,1-dihydroxythian-4-yl)-ethylamino]-3-nitrophenyl]propanoate (PubChem CID 122586229) has the molecular formula C20H30N2O6S and a molecular weight of 426.54 g/mol. Its IUPAC name is methyl 3-cyclopropyl-3-[4-[(1,1-dihydroxythian-4-yl)-ethylamino]-3-nitrophenyl]propanoate.
| Compound Name | methyl 3-cyclopropyl-3-[4-[(1,1-dihydroxythian-4-yl)-ethylamino]-3-nitrophenyl]propanoate |
|---|---|
| PubChem CID | 122586229 |
| Molecular Formula | C20H30N2O6S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | methyl 3-cyclopropyl-3-[4-[(1,1-dihydroxythian-4-yl)-ethylamino]-3-nitrophenyl]propanoate |
| SMILES | CCN(c1ccc(C(CC(=O)OC)C2CC2)cc1[N+](=O)[O-])C1CCS(O)(O)CC1 |
| InChI | InChI=1S/C20H30N2O6S/c1-3-21(16-8-10-29(26,27)11-9-16)18-7-6-15(12-19(18)22(24)25)17(14-4-5-14)13-20(23)28-2/h6-7,12,14,16-17,26-27H,3-5,8-11,13H2,1-2H3 |
| InChIKey | SQCVCHCBNOTNQB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 113.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|