About ethyl 3-[4-[(1,1-dihydroxythian-4-yl)-propylamino]-3-nitrophenyl]-3-methylbutanoate
ethyl 3-[4-[(1,1-dihydroxythian-4-yl)-propylamino]-3-nitrophenyl]-3-methylbutanoate (PubChem CID 122587581) has the molecular formula C21H34N2O6S
and a molecular weight of 442.58 g/mol. Its IUPAC name is ethyl 3-[4-[(1,1-dihydroxythian-4-yl)-propylamino]-3-nitrophenyl]-3-methylbutanoate.
Molecular Properties
| Compound Name | ethyl 3-[4-[(1,1-dihydroxythian-4-yl)-propylamino]-3-nitrophenyl]-3-methylbutanoate |
| PubChem CID | 122587581 |
| Molecular Formula | C21H34N2O6S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | ethyl 3-[4-[(1,1-dihydroxythian-4-yl)-propylamino]-3-nitrophenyl]-3-methylbutanoate |
| SMILES | CCCN(c1ccc(C(C)(C)CC(=O)OCC)cc1[N+](=O)[O-])C1CCS(O)(O)CC1 |
| InChI | InChI=1S/C21H34N2O6S/c1-5-11-22(17-9-12-30(27,28)13-10-17)18-8-7-16(14-19(18)23(25)26)21(3,4)15-20(24)29-6-2/h7-8,14,17,27-28H,5-6,9-13,15H2,1-4H3 |
| InChIKey | SXXXCAHGIMCRGL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 113.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[4-[(1,1-dihydroxythian-4-yl)-propylamino]-3-nitrophenyl]-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[4-[(1,1-dihydroxythian-4-yl)-propylamino]-3-nitrophenyl]-3-methylbutanoate?
The IUPAC name of ethyl 3-[4-[(1,1-dihydroxythian-4-yl)-propylamino]-3-nitrophenyl]-3-methylbutanoate (CID 122587581) is ethyl 3-[4-[(1,1-dihydroxythian-4-yl)-propylamino]-3-nitrophenyl]-3-methylbutanoate.
What is the SMILES notation for ethyl 3-[4-[(1,1-dihydroxythian-4-yl)-propylamino]-3-nitrophenyl]-3-methylbutanoate?
The canonical SMILES for ethyl 3-[4-[(1,1-dihydroxythian-4-yl)-propylamino]-3-nitrophenyl]-3-methylbutanoate is CCCN(c1ccc(C(C)(C)CC(=O)OCC)cc1[N+](=O)[O-])C1CCS(O)(O)CC1.
What is the InChIKey of ethyl 3-[4-[(1,1-dihydroxythian-4-yl)-propylamino]-3-nitrophenyl]-3-methylbutanoate?
The InChIKey is SXXXCAHGIMCRGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34N2O6S/c1-5-11-22(17-9-12-30(27,28)13-10-17)18-8-7-16(14-19(18)23(25)26)21(3,4)15-20(24)29-6-2/h7-8,14,17,27-28H,5-6,9-13,15H2,1-4H3.
What are the key properties of ethyl 3-[4-[(1,1-dihydroxythian-4-yl)-propylamino]-3-nitrophenyl]-3-methylbutanoate?
ethyl 3-[4-[(1,1-dihydroxythian-4-yl)-propylamino]-3-nitrophenyl]-3-methylbutanoate has a molecular weight of 442.58 g/mol, XLogP of 4.95, 9 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[4-[(1,1-dihydroxythian-4-yl)-propylamino]-3-nitrophenyl]-3-methylbutanoate is sourced from PubChem (CID 122587581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).